About 6-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine
6-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136694502) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 6-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine.
Analyze 6-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine?
The IUPAC name of 6-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine (CID 136694502) is 6-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine.
What is the SMILES notation for 6-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine?
The canonical SMILES for 6-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine is CC1=CNc2ncnn2C1.
What is the InChIKey of 6-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine?
The InChIKey is GRTBKAUHNSDHBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c1-5-2-7-6-8-4-9-10(6)3-5/h2,4H,3H2,1H3,(H,7,8,9).
What are the key properties of 6-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine?
6-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine has a molecular weight of 136.16 g/mol, XLogP of 0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine is sourced from PubChem (CID 136694502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).