About 4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 141270841) has the molecular formula C5H7N5
and a molecular weight of 137.15 g/mol. Its IUPAC name is 4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
Analyze 4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (CID 141270841) is 4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine is NC1C=CNc2ncnn21.
What is the InChIKey of 4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is LXMMMVRUJMMIFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N5/c6-4-1-2-7-5-8-3-9-10(4)5/h1-4H,6H2,(H,7,8,9).
What are the key properties of 4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine?
4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 137.15 g/mol, XLogP of -0.33, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 141270841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).