C17H22N2O2 — CID 136696339
2-(1-adamantyl)-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one (PubChem CID 136696339) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-(1-adamantyl)-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(1-adamantyl)-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136696339 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-(1-adamantyl)-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C23CC4CC(CC(C4)C2)C3)nc2c1COCC2 |
| InChI | InChI=1S/C17H22N2O2/c20-15-13-9-21-2-1-14(13)18-16(19-15)17-6-10-3-11(7-17)5-12(4-10)8-17/h10-12H,1-9H2,(H,18,19,20) |
| InChIKey | KLFSDWMPWTZVRS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |