C17H30N2OS — CID 136696683
N-(3-ethoxy-2,2-dimethylcyclobutyl)-8-methyl-3-thia-1-azaspiro[4.5]decan-2-imine (PubChem CID 136696683) has the molecular formula C17H30N2OS and a molecular weight of 310.51 g/mol. Its IUPAC name is N-(3-ethoxy-2,2-dimethylcyclobutyl)-8-methyl-3-thia-1-azaspiro[4.5]decan-2-imine.
| Compound Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-8-methyl-3-thia-1-azaspiro[4.5]decan-2-imine |
|---|---|
| PubChem CID | 136696683 |
| Molecular Formula | C17H30N2OS |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-8-methyl-3-thia-1-azaspiro[4.5]decan-2-imine |
| SMILES | CCOC1CC(/N=C2/NC3(CCC(C)CC3)CS2)C1(C)C |
| InChI | InChI=1S/C17H30N2OS/c1-5-20-14-10-13(16(14,3)4)18-15-19-17(11-21-15)8-6-12(2)7-9-17/h12-14H,5-11H2,1-4H3,(H,18,19) |
| InChIKey | VRZNITTVQWVHLA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|