C13H19N3OS2 — CID 136803572
4-[[(8-methyl-3-thia-1-azaspiro[4.5]decan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 136803572) has the molecular formula C13H19N3OS2 and a molecular weight of 297.45 g/mol. Its IUPAC name is 4-[[(8-methyl-3-thia-1-azaspiro[4.5]decan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(8-methyl-3-thia-1-azaspiro[4.5]decan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 136803572 |
| Molecular Formula | C13H19N3OS2 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-[[(8-methyl-3-thia-1-azaspiro[4.5]decan-2-ylidene)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | CC1CCC2(CC1)CS/C(=N\Cc1csc(=O)[nH]1)N2 |
| InChI | InChI=1S/C13H19N3OS2/c1-9-2-4-13(5-3-9)8-19-11(16-13)14-6-10-7-18-12(17)15-10/h7,9H,2-6,8H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | WCKQZUUYDVMEHP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|