C14H11N3OS2 — CID 136699796
(NE)-N-[1-(2-pyridin-4-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)ethylidene]hydroxylamine (PubChem CID 136699796) has the molecular formula C14H11N3OS2 and a molecular weight of 301.40 g/mol. Its IUPAC name is (NE)-N-[1-(2-pyridin-4-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(2-pyridin-4-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 136699796 |
| Molecular Formula | C14H11N3OS2 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | (NE)-N-[1-(2-pyridin-4-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1sc(-c2ccncc2)nc1-c1cccs1 |
| InChI | InChI=1S/C14H11N3OS2/c1-9(17-18)13-12(11-3-2-8-19-11)16-14(20-13)10-4-6-15-7-5-10/h2-8,18H,1H3/b17-9+ |
| InChIKey | XEERZKNDTLTSCP-RQZCQDPDSA-N |
| XLogP | 4.13 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|