C14H10BrNS2 — CID 79831085
2-(3-bromophenyl)-5-methyl-4-thiophen-2-yl-1,3-thiazole (PubChem CID 79831085) has the molecular formula C14H10BrNS2 and a molecular weight of 336.28 g/mol. Its IUPAC name is 2-(3-bromophenyl)-5-methyl-4-thiophen-2-yl-1,3-thiazole.
| Compound Name | 2-(3-bromophenyl)-5-methyl-4-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 79831085 |
| Molecular Formula | C14H10BrNS2 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 334.94 |
| IUPAC Name | 2-(3-bromophenyl)-5-methyl-4-thiophen-2-yl-1,3-thiazole |
| SMILES | Cc1sc(-c2cccc(Br)c2)nc1-c1cccs1 |
| InChI | InChI=1S/C14H10BrNS2/c1-9-13(12-6-3-7-17-12)16-14(18-9)10-4-2-5-11(15)8-10/h2-8H,1H3 |
| InChIKey | ISVGAWGCONDOTA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |