C12H11BrN2O — CID 136701853
2-(3-bromo-4-methylphenyl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 136701853) has the molecular formula C12H11BrN2O and a molecular weight of 279.14 g/mol. Its IUPAC name is 2-(3-bromo-4-methylphenyl)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(3-bromo-4-methylphenyl)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136701853 |
| Molecular Formula | C12H11BrN2O |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 2-(3-bromo-4-methylphenyl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(-c2ccc(C)c(Br)c2)n1 |
| InChI | InChI=1S/C12H11BrN2O/c1-7-3-4-9(6-10(7)13)12-14-8(2)5-11(16)15-12/h3-6H,1-2H3,(H,14,15,16) |
| InChIKey | JQVNKVAQOYAMRA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |