C18H17N3O5 — CID 136704284
3-(3,4-dihydroxyphenyl)-N-methoxy-1-(4-methoxyphenyl)pyrazole-4-carboxamide (PubChem CID 136704284) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-N-methoxy-1-(4-methoxyphenyl)pyrazole-4-carboxamide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-N-methoxy-1-(4-methoxyphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 136704284 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-N-methoxy-1-(4-methoxyphenyl)pyrazole-4-carboxamide |
| SMILES | CONC(=O)c1cn(-c2ccc(OC)cc2)nc1-c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H17N3O5/c1-25-13-6-4-12(5-7-13)21-10-14(18(24)20-26-2)17(19-21)11-3-8-15(22)16(23)9-11/h3-10,22-23H,1-2H3,(H,20,24) |
| InChIKey | ZMEYRYGUTALZSM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|