C19H18N4S — CID 136705115
3-methyl-5-(4-methylphenyl)-1-phenyl-4,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione (PubChem CID 136705115) has the molecular formula C19H18N4S and a molecular weight of 334.45 g/mol. Its IUPAC name is 3-methyl-5-(4-methylphenyl)-1-phenyl-4,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione.
| Compound Name | 3-methyl-5-(4-methylphenyl)-1-phenyl-4,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione |
|---|---|
| PubChem CID | 136705115 |
| Molecular Formula | C19H18N4S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-methyl-5-(4-methylphenyl)-1-phenyl-4,7-dihydropyrazolo[5,4-d]pyrimidine-6-thione |
| SMILES | Cc1ccc(N2Cc3c(C)nn(-c4ccccc4)c3NC2=S)cc1 |
| InChI | InChI=1S/C19H18N4S/c1-13-8-10-15(11-9-13)22-12-17-14(2)21-23(18(17)20-19(22)24)16-6-4-3-5-7-16/h3-11H,12H2,1-2H3,(H,20,24) |
| InChIKey | OFZRQUISADPOLD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|