C11H17N3O4 — CID 136706910
4-(3,4-dimethoxypyrrolidin-1-yl)-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136706910) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-(3,4-dimethoxypyrrolidin-1-yl)-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136706910 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(N2CC(OC)C(OC)C2)nc[nH]c1=O |
| InChI | InChI=1S/C11H17N3O4/c1-16-7-4-14(5-8(7)17-2)10-9(18-3)11(15)13-6-12-10/h6-8H,4-5H2,1-3H3,(H,12,13,15) |
| InChIKey | NTPVZPOPOWGNRV-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |