C11H15N3O4 — CID 136958326
1-(5-methoxy-6-oxo-1H-pyrimidin-4-yl)piperidine-3-carboxylic acid (PubChem CID 136958326) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 1-(5-methoxy-6-oxo-1H-pyrimidin-4-yl)piperidine-3-carboxylic acid.
| Compound Name | 1-(5-methoxy-6-oxo-1H-pyrimidin-4-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 136958326 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-(5-methoxy-6-oxo-1H-pyrimidin-4-yl)piperidine-3-carboxylic acid |
| SMILES | COc1c(N2CCCC(C(=O)O)C2)nc[nH]c1=O |
| InChI | InChI=1S/C11H15N3O4/c1-18-8-9(12-6-13-10(8)15)14-4-2-3-7(5-14)11(16)17/h6-7H,2-5H2,1H3,(H,16,17)(H,12,13,15) |
| InChIKey | ROHWOEYSLGXNGG-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |