C22H22N4O4 — CID 136707228
6-[(6-ethoxy-1,3-benzodioxol-5-yl)methyl]-2-pyridin-3-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 136707228) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 6-[(6-ethoxy-1,3-benzodioxol-5-yl)methyl]-2-pyridin-3-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(6-ethoxy-1,3-benzodioxol-5-yl)methyl]-2-pyridin-3-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136707228 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 6-[(6-ethoxy-1,3-benzodioxol-5-yl)methyl]-2-pyridin-3-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCOc1cc2c(cc1CN1CCc3nc(-c4cccnc4)[nH]c(=O)c3C1)OCO2 |
| InChI | InChI=1S/C22H22N4O4/c1-2-28-18-9-20-19(29-13-30-20)8-15(18)11-26-7-5-17-16(12-26)22(27)25-21(24-17)14-4-3-6-23-10-14/h3-4,6,8-10H,2,5,7,11-13H2,1H3,(H,24,25,27) |
| InChIKey | JCOLUHYOUUSMTL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |