C13H15N5O — CID 136709758
7-(4-aminophenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136709758) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 7-(4-aminophenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 7-(4-aminophenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136709758 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 7-(4-aminophenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | NC(=O)c1cc2n(n1)C(c1ccc(N)cc1)CCN2 |
| InChI | InChI=1S/C13H15N5O/c14-9-3-1-8(2-4-9)11-5-6-16-12-7-10(13(15)19)17-18(11)12/h1-4,7,11,16H,5-6,14H2,(H2,15,19) |
| InChIKey | AIYWCYBWGMLAPC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|