C15H19N3O3 — CID 136709899
4-[7-(dimethoxymethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]phenol (PubChem CID 136709899) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-[7-(dimethoxymethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]phenol.
| Compound Name | 4-[7-(dimethoxymethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 136709899 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-[7-(dimethoxymethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]phenol |
| SMILES | COC(OC)C1CCNc2cc(-c3ccc(O)cc3)nn21 |
| InChI | InChI=1S/C15H19N3O3/c1-20-15(21-2)13-7-8-16-14-9-12(17-18(13)14)10-3-5-11(19)6-4-10/h3-6,9,13,15-16,19H,7-8H2,1-2H3 |
| InChIKey | JWXJZBRYRWLTEY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|