C4H4N8O2 — CID 136711092
2,4-dioxido-6-(1,2,4-triazol-1-yl)-1,2,4,5-tetrazine-2,4-diium-3-amine (PubChem CID 136711092) has the molecular formula C4H4N8O2 and a molecular weight of 196.13 g/mol. Its IUPAC name is 2,4-dioxido-6-(1,2,4-triazol-1-yl)-1,2,4,5-tetrazine-2,4-diium-3-amine.
| Compound Name | 2,4-dioxido-6-(1,2,4-triazol-1-yl)-1,2,4,5-tetrazine-2,4-diium-3-amine |
|---|---|
| PubChem CID | 136711092 |
| Molecular Formula | C4H4N8O2 |
| Molecular Weight | 196.13 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 2,4-dioxido-6-(1,2,4-triazol-1-yl)-1,2,4,5-tetrazine-2,4-diium-3-amine |
| SMILES | Nc1[n+]([O-])nc(-n2cncn2)n[n+]1[O-] |
| InChI | InChI=1S/C4H4N8O2/c5-3-11(13)8-4(9-12(3)14)10-2-6-1-7-10/h1-2H,5H2 |
| InChIKey | DKUJWCORIBWDLH-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.13 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|