C6H4IN5 — CID 116649073
5-iodo-2-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 116649073) has the molecular formula C6H4IN5 and a molecular weight of 273.04 g/mol. Its IUPAC name is 5-iodo-2-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 5-iodo-2-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 116649073 |
| Molecular Formula | C6H4IN5 |
| Molecular Weight | 273.04 g/mol |
| Exact Mass | 272.95 |
| IUPAC Name | 5-iodo-2-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | Ic1cnc(-n2cncn2)nc1 |
| InChI | InChI=1S/C6H4IN5/c7-5-1-9-6(10-2-5)12-4-8-3-11-12/h1-4H |
| InChIKey | VMFDINJNGDRTKI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.04 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|