C8H7IN4 — CID 66094610
3-iodo-4-(1,2,4-triazol-1-yl)aniline (PubChem CID 66094610) has the molecular formula C8H7IN4 and a molecular weight of 286.08 g/mol. Its IUPAC name is 3-iodo-4-(1,2,4-triazol-1-yl)aniline.
| Compound Name | 3-iodo-4-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 66094610 |
| Molecular Formula | C8H7IN4 |
| Molecular Weight | 286.08 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 3-iodo-4-(1,2,4-triazol-1-yl)aniline |
| SMILES | Nc1ccc(-n2cncn2)c(I)c1 |
| InChI | InChI=1S/C8H7IN4/c9-7-3-6(10)1-2-8(7)13-5-11-4-12-13/h1-5H,10H2 |
| InChIKey | ZTOPKTBVYKUWGW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.08 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|