C10H11ClN4 — CID 114862348
2-[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]ethanamine (PubChem CID 114862348) has the molecular formula C10H11ClN4 and a molecular weight of 222.68 g/mol. Its IUPAC name is 2-[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]ethanamine.
| Compound Name | 2-[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 114862348 |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 2-[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]ethanamine |
| SMILES | NCCc1ccc(Cl)cc1-n1cncn1 |
| InChI | InChI=1S/C10H11ClN4/c11-9-2-1-8(3-4-12)10(5-9)15-7-13-6-14-15/h1-2,5-7H,3-4,12H2 |
| InChIKey | UTSOQEUJXQKYOV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |