C15H19Cl2N5 — CID 120846056
(3aR,6aS)-5-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120846056) has the molecular formula C15H19Cl2N5 and a molecular weight of 340.26 g/mol. Its IUPAC name is (3aR,6aS)-5-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aS)-5-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120846056 |
| Molecular Formula | C15H19Cl2N5 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (3aR,6aS)-5-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | Cl.Clc1ccc(CN2C[C@H]3CNC[C@H]3C2)c(-n2cncn2)c1 |
| InChI | InChI=1S/C15H18ClN5.ClH/c16-14-2-1-11(15(3-14)21-10-18-9-19-21)6-20-7-12-4-17-5-13(12)8-20;/h1-3,9-10,12-13,17H,4-8H2;1H/t12-,13+; |
| InChIKey | KBCBKQDMLOCIAQ-OEEJBDNKSA-N |
| XLogP | 1.99 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |