About 3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile
3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile (PubChem CID 166244207) has the molecular formula C20H19ClN6
and a molecular weight of 378.87 g/mol. Its IUPAC name is 3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile |
| PubChem CID | 166244207 |
| Molecular Formula | C20H19ClN6 |
| Molecular Weight | 378.87 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile |
| SMILES | N#Cc1cccc(NC2CCN(Cc3ccc(Cl)cc3-n3cncn3)C2)c1 |
| InChI | InChI=1S/C20H19ClN6/c21-17-5-4-16(20(9-17)27-14-23-13-24-27)11-26-7-6-19(12-26)25-18-3-1-2-15(8-18)10-22/h1-5,8-9,13-14,19,25H,6-7,11-12H2 |
| InChIKey | SJFGBPCJGOBEEF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 69.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile?
The IUPAC name of 3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile (CID 166244207) is 3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile.
What is the SMILES notation for 3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile?
The canonical SMILES for 3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile is N#Cc1cccc(NC2CCN(Cc3ccc(Cl)cc3-n3cncn3)C2)c1.
What is the InChIKey of 3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile?
The InChIKey is SJFGBPCJGOBEEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClN6/c21-17-5-4-16(20(9-17)27-14-23-13-24-27)11-26-7-6-19(12-26)25-18-3-1-2-15(8-18)10-22/h1-5,8-9,13-14,19,25H,6-7,11-12H2.
What are the key properties of 3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile?
3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile has a molecular weight of 378.87 g/mol, XLogP of 3.48, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-[[4-chloro-2-(1,2,4-triazol-1-yl)phenyl]methyl]pyrrolidin-3-yl]amino]benzonitrile is sourced from PubChem (CID 166244207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).