C9H10N4O — CID 82512225
4-methoxy-3-(1,2,4-triazol-1-yl)aniline (PubChem CID 82512225) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is 4-methoxy-3-(1,2,4-triazol-1-yl)aniline.
| Compound Name | 4-methoxy-3-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 82512225 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 4-methoxy-3-(1,2,4-triazol-1-yl)aniline |
| SMILES | COc1ccc(N)cc1-n1cncn1 |
| InChI | InChI=1S/C9H10N4O/c1-14-9-3-2-7(10)4-8(9)13-6-11-5-12-13/h2-6H,10H2,1H3 |
| InChIKey | HUIRXTZUXAXCOI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|