C10H12N4O — CID 84672375
[2-methoxy-6-(1,2,4-triazol-1-yl)phenyl]methanamine (PubChem CID 84672375) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is [2-methoxy-6-(1,2,4-triazol-1-yl)phenyl]methanamine.
| Compound Name | [2-methoxy-6-(1,2,4-triazol-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 84672375 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | [2-methoxy-6-(1,2,4-triazol-1-yl)phenyl]methanamine |
| SMILES | COc1cccc(-n2cncn2)c1CN |
| InChI | InChI=1S/C10H12N4O/c1-15-10-4-2-3-9(8(10)5-11)14-7-12-6-13-14/h2-4,6-7H,5,11H2,1H3 |
| InChIKey | ICBBZRIEBXJAQV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |