C14H18FN3 — CID 70834017
1-[2-(2,2-dimethylbutyl)-3-fluorophenyl]-1,2,4-triazole (PubChem CID 70834017) has the molecular formula C14H18FN3 and a molecular weight of 247.32 g/mol. Its IUPAC name is 1-[2-(2,2-dimethylbutyl)-3-fluorophenyl]-1,2,4-triazole.
| Compound Name | 1-[2-(2,2-dimethylbutyl)-3-fluorophenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 70834017 |
| Molecular Formula | C14H18FN3 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 1-[2-(2,2-dimethylbutyl)-3-fluorophenyl]-1,2,4-triazole |
| SMILES | CCC(C)(C)Cc1c(F)cccc1-n1cncn1 |
| InChI | InChI=1S/C14H18FN3/c1-4-14(2,3)8-11-12(15)6-5-7-13(11)18-10-16-9-17-18/h5-7,9-10H,4,8H2,1-3H3 |
| InChIKey | XLASFTSHJINXHH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |