C10H9N3O2 — CID 84671353
3-methoxy-4-(1,2,4-triazol-1-yl)benzaldehyde (PubChem CID 84671353) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-methoxy-4-(1,2,4-triazol-1-yl)benzaldehyde.
| Compound Name | 3-methoxy-4-(1,2,4-triazol-1-yl)benzaldehyde |
|---|---|
| PubChem CID | 84671353 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 3-methoxy-4-(1,2,4-triazol-1-yl)benzaldehyde |
| SMILES | COc1cc(C=O)ccc1-n1cncn1 |
| InChI | InChI=1S/C10H9N3O2/c1-15-10-4-8(5-14)2-3-9(10)13-7-11-6-12-13/h2-7H,1H3 |
| InChIKey | CEGCYSRZCLOFHR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|