About dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate
dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate (PubChem CID 159846685) has the molecular formula C12H10K2N2O5
and a molecular weight of 340.42 g/mol. Its IUPAC name is dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate.
Molecular Properties
| Compound Name | dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate |
| PubChem CID | 159846685 |
| Molecular Formula | C12H10K2N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate |
| SMILES | COc1cc(C=O)ccc1-n1ccnc1.O=C([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C11H10N2O2.CH2O3.2K/c1-15-11-6-9(7-14)2-3-10(11)13-5-4-12-8-13;2-1(3)4;;/h2-8H,1H3;(H2,2,3,4);;/q;;2*+1/p-2 |
| InChIKey | NPKAFKCEXNVRNR-UHFFFAOYSA-L |
| XLogP | -6.75 |
| TPSA | 107.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | -6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate?
The IUPAC name of dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate (CID 159846685) is dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate.
What is the SMILES notation for dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate?
The canonical SMILES for dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate is COc1cc(C=O)ccc1-n1ccnc1.O=C([O-])[O-].[K+].[K+].
What is the InChIKey of dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate?
The InChIKey is NPKAFKCEXNVRNR-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H10N2O2.CH2O3.2K/c1-15-11-6-9(7-14)2-3-10(11)13-5-4-12-8-13;2-1(3)4;;/h2-8H,1H3;(H2,2,3,4);;/q;;2*+1/p-2.
What are the key properties of dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate?
dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate has a molecular weight of 340.42 g/mol, XLogP of -6.75, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;4-imidazol-1-yl-3-methoxybenzaldehyde;carbonate is sourced from PubChem (CID 159846685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).