C26H21N3O2 — CID 59170805
(E)-N-(9H-fluoren-1-yl)-3-(4-imidazol-1-yl-3-methoxyphenyl)prop-2-enamide (PubChem CID 59170805) has the molecular formula C26H21N3O2 and a molecular weight of 407.47 g/mol. Its IUPAC name is (E)-N-(9H-fluoren-1-yl)-3-(4-imidazol-1-yl-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(9H-fluoren-1-yl)-3-(4-imidazol-1-yl-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 59170805 |
| Molecular Formula | C26H21N3O2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (E)-N-(9H-fluoren-1-yl)-3-(4-imidazol-1-yl-3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cccc3c2Cc2ccccc2-3)ccc1-n1ccnc1 |
| InChI | InChI=1S/C26H21N3O2/c1-31-25-15-18(9-11-24(25)29-14-13-27-17-29)10-12-26(30)28-23-8-4-7-21-20-6-3-2-5-19(20)16-22(21)23/h2-15,17H,16H2,1H3,(H,28,30)/b12-10+ |
| InChIKey | FZYUTPZOKJJUQK-ZRDIBKRKSA-N |
| XLogP | 5.10 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|