C25H27N3O4 — CID 59170792
tert-butyl (2S)-2-[[(E)-3-(4-imidazol-1-yl-3-methoxyphenyl)prop-2-enoyl]amino]-2-phenylacetate (PubChem CID 59170792) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(E)-3-(4-imidazol-1-yl-3-methoxyphenyl)prop-2-enoyl]amino]-2-phenylacetate.
| Compound Name | tert-butyl (2S)-2-[[(E)-3-(4-imidazol-1-yl-3-methoxyphenyl)prop-2-enoyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 59170792 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | tert-butyl (2S)-2-[[(E)-3-(4-imidazol-1-yl-3-methoxyphenyl)prop-2-enoyl]amino]-2-phenylacetate |
| SMILES | COc1cc(/C=C/C(=O)N[C@H](C(=O)OC(C)(C)C)c2ccccc2)ccc1-n1ccnc1 |
| InChI | InChI=1S/C25H27N3O4/c1-25(2,3)32-24(30)23(19-8-6-5-7-9-19)27-22(29)13-11-18-10-12-20(21(16-18)31-4)28-15-14-26-17-28/h5-17,23H,1-4H3,(H,27,29)/b13-11+/t23-/m0/s1 |
| InChIKey | LWQKWDXMJVKSFG-BWSGXRDBSA-N |
| XLogP | 4.09 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|