C8H7BrN4 — CID 84701038
2-bromo-6-(1,2,4-triazol-1-yl)aniline (PubChem CID 84701038) has the molecular formula C8H7BrN4 and a molecular weight of 239.08 g/mol. Its IUPAC name is 2-bromo-6-(1,2,4-triazol-1-yl)aniline.
| Compound Name | 2-bromo-6-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 84701038 |
| Molecular Formula | C8H7BrN4 |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | 2-bromo-6-(1,2,4-triazol-1-yl)aniline |
| SMILES | Nc1c(Br)cccc1-n1cncn1 |
| InChI | InChI=1S/C8H7BrN4/c9-6-2-1-3-7(8(6)10)13-5-11-4-12-13/h1-5H,10H2 |
| InChIKey | HOGYJXAVDRVZLT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|