C11H12N4 — CID 103144020
8-(1,2,4-triazol-1-yl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 103144020) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is 8-(1,2,4-triazol-1-yl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 8-(1,2,4-triazol-1-yl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 103144020 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 8-(1,2,4-triazol-1-yl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1cc2c(c(-n3cncn3)c1)CNCC2 |
| InChI | InChI=1S/C11H12N4/c1-2-9-4-5-12-6-10(9)11(3-1)15-8-13-7-14-15/h1-3,7-8,12H,4-6H2 |
| InChIKey | YMWLPOCYTRYHMQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |