C11H9N5 — CID 43449577
5-(1,2,4-triazol-1-yl)quinolin-8-amine (PubChem CID 43449577) has the molecular formula C11H9N5 and a molecular weight of 211.23 g/mol. Its IUPAC name is 5-(1,2,4-triazol-1-yl)quinolin-8-amine.
| Compound Name | 5-(1,2,4-triazol-1-yl)quinolin-8-amine |
|---|---|
| PubChem CID | 43449577 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 5-(1,2,4-triazol-1-yl)quinolin-8-amine |
| SMILES | Nc1ccc(-n2cncn2)c2cccnc12 |
| InChI | InChI=1S/C11H9N5/c12-9-3-4-10(16-7-13-6-15-16)8-2-1-5-14-11(8)9/h1-7H,12H2 |
| InChIKey | DZJIUKGGDHBUBX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|