C14H9N5 — CID 91056975
2-(1,2,4-triazol-1-yl)-1,10-phenanthroline (PubChem CID 91056975) has the molecular formula C14H9N5 and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-(1,2,4-triazol-1-yl)-1,10-phenanthroline.
| Compound Name | 2-(1,2,4-triazol-1-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 91056975 |
| Molecular Formula | C14H9N5 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-(1,2,4-triazol-1-yl)-1,10-phenanthroline |
| SMILES | c1cnc2c(c1)ccc1ccc(-n3cncn3)nc12 |
| InChI | InChI=1S/C14H9N5/c1-2-10-3-4-11-5-6-12(19-9-15-8-17-19)18-14(11)13(10)16-7-1/h1-9H |
| InChIKey | KBWKDODUAKAWBF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|