C9H11N5 — CID 58333445
2-propan-2-yl-5-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 58333445) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-propan-2-yl-5-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 2-propan-2-yl-5-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 58333445 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 2-propan-2-yl-5-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | CC(C)c1ncc(-n2cncn2)cn1 |
| InChI | InChI=1S/C9H11N5/c1-7(2)9-11-3-8(4-12-9)14-6-10-5-13-14/h3-7H,1-2H3 |
| InChIKey | NPOQUWPMQMGWDW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |