C11H8N6O4 — CID 136712315
3-[(2-nitrophenyl)methyl]-5,6-dihydrotriazolo[4,5-d]pyridazine-4,7-dione (PubChem CID 136712315) has the molecular formula C11H8N6O4 and a molecular weight of 288.22 g/mol. Its IUPAC name is 3-[(2-nitrophenyl)methyl]-5,6-dihydrotriazolo[4,5-d]pyridazine-4,7-dione.
| Compound Name | 3-[(2-nitrophenyl)methyl]-5,6-dihydrotriazolo[4,5-d]pyridazine-4,7-dione |
|---|---|
| PubChem CID | 136712315 |
| Molecular Formula | C11H8N6O4 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 3-[(2-nitrophenyl)methyl]-5,6-dihydrotriazolo[4,5-d]pyridazine-4,7-dione |
| SMILES | O=c1[nH][nH]c(=O)c2c1nnn2Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8N6O4/c18-10-8-9(11(19)14-13-10)16(15-12-8)5-6-3-1-2-4-7(6)17(20)21/h1-4H,5H2,(H,13,18)(H,14,19) |
| InChIKey | OBTOXIRVUBFRDV-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 139.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|