C10H10N6O2 — CID 136713291
3-amino-N-[(Z)-(2-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 136713291) has the molecular formula C10H10N6O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 3-amino-N-[(Z)-(2-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-[(Z)-(2-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 136713291 |
| Molecular Formula | C10H10N6O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 3-amino-N-[(Z)-(2-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Nc1n[nH]c(C(=O)N/N=C\c2ccccc2O)n1 |
| InChI | InChI=1S/C10H10N6O2/c11-10-13-8(14-16-10)9(18)15-12-5-6-3-1-2-4-7(6)17/h1-5,17H,(H,15,18)(H3,11,13,14,16)/b12-5- |
| InChIKey | YLPKQLINUHHHGV-XGICHPGQSA-N |
| XLogP | -0.14 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|