C24H19BrN4O4S — CID 136714282
(5R)-5-(4-bromophenyl)-2-[(3-nitrophenyl)methylsulfanyl]-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 136714282) has the molecular formula C24H19BrN4O4S and a molecular weight of 539.41 g/mol. Its IUPAC name is (5R)-5-(4-bromophenyl)-2-[(3-nitrophenyl)methylsulfanyl]-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | (5R)-5-(4-bromophenyl)-2-[(3-nitrophenyl)methylsulfanyl]-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 136714282 |
| Molecular Formula | C24H19BrN4O4S |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 538.03 |
| IUPAC Name | (5R)-5-(4-bromophenyl)-2-[(3-nitrophenyl)methylsulfanyl]-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | O=C1CCCC2=C1[C@@H](c1ccc(Br)cc1)c1c(nc(SCc3cccc([N+](=O)[O-])c3)[nH]c1=O)N2 |
| InChI | InChI=1S/C24H19BrN4O4S/c25-15-9-7-14(8-10-15)19-20-17(5-2-6-18(20)30)26-22-21(19)23(31)28-24(27-22)34-12-13-3-1-4-16(11-13)29(32)33/h1,3-4,7-11,19H,2,5-6,12H2,(H2,26,27,28,31)/t19-/m1/s1 |
| InChIKey | BCDWTAMXNYJAIV-LJQANCHMSA-N |
| XLogP | 5.30 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|