C36H28O16 — CID 136715846
[4,6-dihydroxy-5-oxo-1,8-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]benzo[7]annulen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 136715846) has the molecular formula C36H28O16 and a molecular weight of 716.60 g/mol. Its IUPAC name is [4,6-dihydroxy-5-oxo-1,8-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]benzo[7]annulen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [4,6-dihydroxy-5-oxo-1,8-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]benzo[7]annulen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 136715846 |
| Molecular Formula | C36H28O16 |
| Molecular Weight | 716.60 g/mol |
| Exact Mass | 716.14 |
| IUPAC Name | [4,6-dihydroxy-5-oxo-1,8-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]benzo[7]annulen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(Oc1cc([C@H]2Oc3cc(O)cc(O)c3C[C@H]2O)c2cc([C@H]3Oc4cc(O)cc(O)c4C[C@H]3O)cc(O)c(=O)c2c1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C36H28O16/c37-14-5-20(39)18-9-25(44)34(50-27(18)7-14)12-1-16-17(35-26(45)10-19-21(40)6-15(38)8-28(19)51-35)11-29(33(48)30(16)32(47)24(43)2-12)52-36(49)13-3-22(41)31(46)23(42)4-13/h1-8,11,25-26,34-35,37-42,44-46,48H,9-10H2,(H,43,47)/t25-,26-,34-,35-/m1/s1 |
| InChIKey | HZPITSRAJKWSHT-CJSXLACTSA-N |
| XLogP | 2.84 |
| TPSA | 284.36 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.60 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|