C36H28O16 — CID 18974656
[3,4-dihydroxy-5-oxo-1,8-bis(3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl)benzo[7]annulen-6-yl] 3,4,5-trihydroxybenzoate (PubChem CID 18974656) has the molecular formula C36H28O16 and a molecular weight of 716.60 g/mol. Its IUPAC name is [3,4-dihydroxy-5-oxo-1,8-bis(3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl)benzo[7]annulen-6-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [3,4-dihydroxy-5-oxo-1,8-bis(3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl)benzo[7]annulen-6-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 18974656 |
| Molecular Formula | C36H28O16 |
| Molecular Weight | 716.60 g/mol |
| Exact Mass | 716.14 |
| IUPAC Name | [3,4-dihydroxy-5-oxo-1,8-bis(3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl)benzo[7]annulen-6-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(Oc1cc(C2Oc3cc(O)cc(O)c3CC2O)cc2c(C3Oc4cc(O)cc(O)c4CC3O)cc(O)c(O)c2c1=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C36H28O16/c37-14-5-20(39)18-10-25(44)34(50-27(18)7-14)12-1-16-17(35-26(45)11-19-21(40)6-15(38)8-28(19)51-35)9-24(43)32(47)30(16)33(48)29(4-12)52-36(49)13-2-22(41)31(46)23(42)3-13/h1-9,25-26,34-35,37-47H,10-11H2 |
| InChIKey | OGJAEMWMWKYTFR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 284.36 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.60 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|