C25H21I2N3O5 — CID 136715849
N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[(2Z)-2-[(2-hydroxy-3,5-diiodophenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 136715849) has the molecular formula C25H21I2N3O5 and a molecular weight of 697.27 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[(2Z)-2-[(2-hydroxy-3,5-diiodophenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[(2Z)-2-[(2-hydroxy-3,5-diiodophenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 136715849 |
| Molecular Formula | C25H21I2N3O5 |
| Molecular Weight | 697.27 g/mol |
| Exact Mass | 696.96 |
| IUPAC Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[(2Z)-2-[(2-hydroxy-3,5-diiodophenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(/C=C(\NC(=O)c2ccccc2)C(=O)N/N=C\c2cc(I)cc(I)c2O)c1 |
| InChI | InChI=1S/C25H21I2N3O5/c1-34-19-8-9-22(35-2)16(11-19)12-21(29-24(32)15-6-4-3-5-7-15)25(33)30-28-14-17-10-18(26)13-20(27)23(17)31/h3-14,31H,1-2H3,(H,29,32)(H,30,33)/b21-12-,28-14- |
| InChIKey | JMWPJNCMKFQNES-JJLYNXHHSA-N |
| XLogP | 4.54 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.27 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|