C29H30BrN3O6 — CID 45037689
N-[(Z)-3-[(2E)-2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 45037689) has the molecular formula C29H30BrN3O6 and a molecular weight of 596.48 g/mol. Its IUPAC name is N-[(Z)-3-[(2E)-2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(2E)-2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 45037689 |
| Molecular Formula | C29H30BrN3O6 |
| Molecular Weight | 596.48 g/mol |
| Exact Mass | 595.13 |
| IUPAC Name | N-[(Z)-3-[(2E)-2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)/C(=C/c2cc(OC)ccc2OC)NC(=O)c2ccccc2)cc(Br)c1OCC |
| InChI | InChI=1S/C29H30BrN3O6/c1-5-38-26-15-19(14-23(30)27(26)39-6-2)18-31-33-29(35)24(32-28(34)20-10-8-7-9-11-20)17-21-16-22(36-3)12-13-25(21)37-4/h7-18H,5-6H2,1-4H3,(H,32,34)(H,33,35)/b24-17-,31-18+ |
| InChIKey | OBNBGLJEQCNSMI-DLEAAUTNSA-N |
| XLogP | 5.18 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|