C9H15N5O3 — CID 136716128
(2S)-2-amino-5-[(4-amino-6-oxo-1H-pyrimidin-2-yl)amino]pentanoic acid (PubChem CID 136716128) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is (2S)-2-amino-5-[(4-amino-6-oxo-1H-pyrimidin-2-yl)amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[(4-amino-6-oxo-1H-pyrimidin-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 136716128 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (2S)-2-amino-5-[(4-amino-6-oxo-1H-pyrimidin-2-yl)amino]pentanoic acid |
| SMILES | Nc1cc(=O)[nH]c(NCCC[C@H](N)C(=O)O)n1 |
| InChI | InChI=1S/C9H15N5O3/c10-5(8(16)17)2-1-3-12-9-13-6(11)4-7(15)14-9/h4-5H,1-3,10H2,(H,16,17)(H4,11,12,13,14,15)/t5-/m0/s1 |
| InChIKey | YMJJDLGWAUEELP-YFKPBYRVSA-N |
| XLogP | -1.04 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|