C10H16N4O3 — CID 135427843
2-amino-5-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]pentanoic acid (PubChem CID 135427843) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-amino-5-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]pentanoic acid.
| Compound Name | 2-amino-5-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 135427843 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-amino-5-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]pentanoic acid |
| SMILES | Cc1cc(=O)[nH]c(NCCCC(N)C(=O)O)n1 |
| InChI | InChI=1S/C10H16N4O3/c1-6-5-8(15)14-10(13-6)12-4-2-3-7(11)9(16)17/h5,7H,2-4,11H2,1H3,(H,16,17)(H2,12,13,14,15) |
| InChIKey | RQWQNTQQCCFQOI-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|