C13H21N5O4 — CID 137147047
6-(methylamino)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexanoic acid (PubChem CID 137147047) has the molecular formula C13H21N5O4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 6-(methylamino)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexanoic acid.
| Compound Name | 6-(methylamino)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 137147047 |
| Molecular Formula | C13H21N5O4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 6-(methylamino)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexanoic acid |
| SMILES | CNCCCCC(NC(=O)Nc1nc(C)cc(=O)[nH]1)C(=O)O |
| InChI | InChI=1S/C13H21N5O4/c1-8-7-10(19)17-12(15-8)18-13(22)16-9(11(20)21)5-3-4-6-14-2/h7,9,14H,3-6H2,1-2H3,(H,20,21)(H3,15,16,17,18,19,22) |
| InChIKey | RIDXNGDQTHLYSM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|