C12H19N5O4 — CID 137091802
6-amino-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexanoic acid (PubChem CID 137091802) has the molecular formula C12H19N5O4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 6-amino-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 137091802 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 6-amino-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexanoic acid |
| SMILES | Cc1cc(=O)[nH]c(NC(=O)NC(CCCCN)C(=O)O)n1 |
| InChI | InChI=1S/C12H19N5O4/c1-7-6-9(18)16-11(14-7)17-12(21)15-8(10(19)20)4-2-3-5-13/h6,8H,2-5,13H2,1H3,(H,19,20)(H3,14,15,16,17,18,21) |
| InChIKey | QKVFALPKQVBOSM-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|