C30H28N6O — CID 136718412
4-tert-butyl-2,6-bis[(Z)-(quinolin-2-ylhydrazinylidene)methyl]phenol (PubChem CID 136718412) has the molecular formula C30H28N6O and a molecular weight of 488.60 g/mol. Its IUPAC name is 4-tert-butyl-2,6-bis[(Z)-(quinolin-2-ylhydrazinylidene)methyl]phenol.
| Compound Name | 4-tert-butyl-2,6-bis[(Z)-(quinolin-2-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 136718412 |
| Molecular Formula | C30H28N6O |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 4-tert-butyl-2,6-bis[(Z)-(quinolin-2-ylhydrazinylidene)methyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N\Nc2ccc3ccccc3n2)c(O)c(/C=N\Nc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C30H28N6O/c1-30(2,3)24-16-22(18-31-35-27-14-12-20-8-4-6-10-25(20)33-27)29(37)23(17-24)19-32-36-28-15-13-21-9-5-7-11-26(21)34-28/h4-19,37H,1-3H3,(H,33,35)(H,34,36)/b31-18-,32-19- |
| InChIKey | KKISYFASUYSQQX-HEZNUULDSA-N |
| XLogP | 6.68 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|