C16H19N3O4 — CID 136718552
ethyl (2R,3R)-2-methyl-3-[(4-oxo-3H-quinazoline-2-carbonyl)amino]butanoate (PubChem CID 136718552) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is ethyl (2R,3R)-2-methyl-3-[(4-oxo-3H-quinazoline-2-carbonyl)amino]butanoate.
| Compound Name | ethyl (2R,3R)-2-methyl-3-[(4-oxo-3H-quinazoline-2-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 136718552 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | ethyl (2R,3R)-2-methyl-3-[(4-oxo-3H-quinazoline-2-carbonyl)amino]butanoate |
| SMILES | CCOC(=O)[C@H](C)[C@@H](C)NC(=O)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H19N3O4/c1-4-23-16(22)9(2)10(3)17-15(21)13-18-12-8-6-5-7-11(12)14(20)19-13/h5-10H,4H2,1-3H3,(H,17,21)(H,18,19,20)/t9-,10-/m1/s1 |
| InChIKey | XGXYQWQMSMNYPB-NXEZZACHSA-N |
| XLogP | 1.24 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |