C12H13N3O3 — CID 136759238
N-(1-hydroxypropan-2-yl)-4-oxo-3H-quinazoline-2-carboxamide (PubChem CID 136759238) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-4-oxo-3H-quinazoline-2-carboxamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-4-oxo-3H-quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 136759238 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-4-oxo-3H-quinazoline-2-carboxamide |
| SMILES | CC(CO)NC(=O)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H13N3O3/c1-7(6-16)13-12(18)10-14-9-5-3-2-4-8(9)11(17)15-10/h2-5,7,16H,6H2,1H3,(H,13,18)(H,14,15,17) |
| InChIKey | LWLKMMBUKPGSCN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |