C21H15BrF6N4O2 — CID 136718768
(5S,7R)-5-(4-bromophenyl)-N-[4-(trifluoromethoxy)phenyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136718768) has the molecular formula C21H15BrF6N4O2 and a molecular weight of 549.27 g/mol. Its IUPAC name is (5S,7R)-5-(4-bromophenyl)-N-[4-(trifluoromethoxy)phenyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7R)-5-(4-bromophenyl)-N-[4-(trifluoromethoxy)phenyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136718768 |
| Molecular Formula | C21H15BrF6N4O2 |
| Molecular Weight | 549.27 g/mol |
| Exact Mass | 548.03 |
| IUPAC Name | (5S,7R)-5-(4-bromophenyl)-N-[4-(trifluoromethoxy)phenyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1cc2n(n1)[C@@H](C(F)(F)F)C[C@@H](c1ccc(Br)cc1)N2 |
| InChI | InChI=1S/C21H15BrF6N4O2/c22-12-3-1-11(2-4-12)15-9-17(20(23,24)25)32-18(30-15)10-16(31-32)19(33)29-13-5-7-14(8-6-13)34-21(26,27)28/h1-8,10,15,17,30H,9H2,(H,29,33)/t15-,17+/m0/s1 |
| InChIKey | PGIFGHZKSAEYCE-DOTOQJQBSA-N |
| XLogP | 6.46 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.27 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |