C20H15BrClF3N4O — CID 994012
(5R,7R)-5-(4-bromophenyl)-N-(3-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 994012) has the molecular formula C20H15BrClF3N4O and a molecular weight of 499.72 g/mol. Its IUPAC name is (5R,7R)-5-(4-bromophenyl)-N-(3-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7R)-5-(4-bromophenyl)-N-(3-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 994012 |
| Molecular Formula | C20H15BrClF3N4O |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | (5R,7R)-5-(4-bromophenyl)-N-(3-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cc2n(n1)[C@@H](C(F)(F)F)C[C@H](c1ccc(Br)cc1)N2 |
| InChI | InChI=1S/C20H15BrClF3N4O/c21-12-6-4-11(5-7-12)15-9-17(20(23,24)25)29-18(27-15)10-16(28-29)19(30)26-14-3-1-2-13(22)8-14/h1-8,10,15,17,27H,9H2,(H,26,30)/t15-,17-/m1/s1 |
| InChIKey | FPYZZCPKBBFSGQ-NVXWUHKLSA-N |
| XLogP | 6.21 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |