C13H11F3N4S — CID 136718912
(5R,7S)-5-(5-methylthiophen-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonitrile (PubChem CID 136718912) has the molecular formula C13H11F3N4S and a molecular weight of 312.32 g/mol. Its IUPAC name is (5R,7S)-5-(5-methylthiophen-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonitrile.
| Compound Name | (5R,7S)-5-(5-methylthiophen-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonitrile |
|---|---|
| PubChem CID | 136718912 |
| Molecular Formula | C13H11F3N4S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (5R,7S)-5-(5-methylthiophen-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonitrile |
| SMILES | Cc1ccc([C@H]2C[C@@H](C(F)(F)F)n3ncc(C#N)c3N2)s1 |
| InChI | InChI=1S/C13H11F3N4S/c1-7-2-3-10(21-7)9-4-11(13(14,15)16)20-12(19-9)8(5-17)6-18-20/h2-3,6,9,11,19H,4H2,1H3/t9-,11+/m1/s1 |
| InChIKey | BTVYRQUGPDQKAD-KOLCDFICSA-N |
| XLogP | 3.79 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |